C38H45N7O3 — CID 178026081
3-[6-[1-[[4-[4-[3-methanimidoyl-4-(methylamino)anilino]piperidin-1-yl]phenyl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 178026081) has the molecular formula C38H45N7O3 and a molecular weight of 647.82 g/mol. Its IUPAC name is 3-[6-[1-[[4-[4-[3-methanimidoyl-4-(methylamino)anilino]piperidin-1-yl]phenyl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-[[4-[4-[3-methanimidoyl-4-(methylamino)anilino]piperidin-1-yl]phenyl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178026081 |
| Molecular Formula | C38H45N7O3 |
| Molecular Weight | 647.82 g/mol |
| Exact Mass | 647.36 |
| IUPAC Name | 3-[6-[1-[[4-[4-[3-methanimidoyl-4-(methylamino)anilino]piperidin-1-yl]phenyl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [H]/N=C/c1cc(NC2CCN(c3ccc(CN4CCC(c5ccc6c(c5)CN(C5CCC(=O)NC5=O)C6=O)CC4)cc3)CC2)ccc1NC |
| InChI | InChI=1S/C38H45N7O3/c1-40-34-9-5-31(21-28(34)22-39)41-30-14-18-44(19-15-30)32-6-2-25(3-7-32)23-43-16-12-26(13-17-43)27-4-8-33-29(20-27)24-45(38(33)48)35-10-11-36(46)42-37(35)47/h2-9,20-22,26,30,35,39-41H,10-19,23-24H2,1H3,(H,42,46,47)/b39-22+ |
| InChIKey | ANAFAOPGPNNVCJ-WVKHYPTHSA-N |
| XLogP | 4.95 |
| TPSA | 120.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.82 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|