C11H23N — CID 178026698
4,5-dimethyl-4-azaspiro[2.5]octane;ethane (PubChem CID 178026698) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is 4,5-dimethyl-4-azaspiro[2.5]octane;ethane.
| Compound Name | 4,5-dimethyl-4-azaspiro[2.5]octane;ethane |
|---|---|
| PubChem CID | 178026698 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 4,5-dimethyl-4-azaspiro[2.5]octane;ethane |
| SMILES | CC.CC1CCCC2(CC2)N1C |
| InChI | InChI=1S/C9H17N.C2H6/c1-8-4-3-5-9(6-7-9)10(8)2;1-2/h8H,3-7H2,1-2H3;1-2H3 |
| InChIKey | NKBRNGXNFFYNAJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |