C11H9BrN2O3 — CID 178029475
(6-bromo-1-oxo-2H-isoquinolin-3-yl)methylcarbamic acid (PubChem CID 178029475) has the molecular formula C11H9BrN2O3 and a molecular weight of 297.11 g/mol. Its IUPAC name is (6-bromo-1-oxo-2H-isoquinolin-3-yl)methylcarbamic acid.
| Compound Name | (6-bromo-1-oxo-2H-isoquinolin-3-yl)methylcarbamic acid |
|---|---|
| PubChem CID | 178029475 |
| Molecular Formula | C11H9BrN2O3 |
| Molecular Weight | 297.11 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | (6-bromo-1-oxo-2H-isoquinolin-3-yl)methylcarbamic acid |
| SMILES | O=C(O)NCc1cc2cc(Br)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C11H9BrN2O3/c12-7-1-2-9-6(3-7)4-8(14-10(9)15)5-13-11(16)17/h1-4,13H,5H2,(H,14,15)(H,16,17) |
| InChIKey | OLYPWQHBTOLMTE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.11 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |