C17H14FN5O4S — CID 178030232
3-fluoro-N-[4-[(6-methoxypyridazin-3-yl)sulfamoyl]phenyl]pyridine-2-carboxamide (PubChem CID 178030232) has the molecular formula C17H14FN5O4S and a molecular weight of 403.40 g/mol. Its IUPAC name is 3-fluoro-N-[4-[(6-methoxypyridazin-3-yl)sulfamoyl]phenyl]pyridine-2-carboxamide.
| Compound Name | 3-fluoro-N-[4-[(6-methoxypyridazin-3-yl)sulfamoyl]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 178030232 |
| Molecular Formula | C17H14FN5O4S |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 3-fluoro-N-[4-[(6-methoxypyridazin-3-yl)sulfamoyl]phenyl]pyridine-2-carboxamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(NC(=O)c3ncccc3F)cc2)nn1 |
| InChI | InChI=1S/C17H14FN5O4S/c1-27-15-9-8-14(21-22-15)23-28(25,26)12-6-4-11(5-7-12)20-17(24)16-13(18)3-2-10-19-16/h2-10H,1H3,(H,20,24)(H,21,23) |
| InChIKey | ICOCUAPBLSLIMU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |