C18H16N4O5S — CID 6414370
2-hydroxy-N-[4-[(6-methoxypyridazin-3-yl)sulfamoyl]phenyl]benzamide (PubChem CID 6414370) has the molecular formula C18H16N4O5S and a molecular weight of 400.42 g/mol. Its IUPAC name is 2-hydroxy-N-[4-[(6-methoxypyridazin-3-yl)sulfamoyl]phenyl]benzamide.
| Compound Name | 2-hydroxy-N-[4-[(6-methoxypyridazin-3-yl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 6414370 |
| Molecular Formula | C18H16N4O5S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 2-hydroxy-N-[4-[(6-methoxypyridazin-3-yl)sulfamoyl]phenyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(NC(=O)c3ccccc3O)cc2)nn1 |
| InChI | InChI=1S/C18H16N4O5S/c1-27-17-11-10-16(20-21-17)22-28(25,26)13-8-6-12(7-9-13)19-18(24)14-4-2-3-5-15(14)23/h2-11,23H,1H3,(H,19,24)(H,20,22) |
| InChIKey | CEKUKBDPLSQLJL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |