C17H23NO2S — CID 178035531
methyl 4-[(6S)-2-methylsulfanyl-7-azaspiro[3.5]nonan-6-yl]benzoate (PubChem CID 178035531) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is methyl 4-[(6S)-2-methylsulfanyl-7-azaspiro[3.5]nonan-6-yl]benzoate.
| Compound Name | methyl 4-[(6S)-2-methylsulfanyl-7-azaspiro[3.5]nonan-6-yl]benzoate |
|---|---|
| PubChem CID | 178035531 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | methyl 4-[(6S)-2-methylsulfanyl-7-azaspiro[3.5]nonan-6-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2CC3(CCN2)CC(SC)C3)cc1 |
| InChI | InChI=1S/C17H23NO2S/c1-20-16(19)13-5-3-12(4-6-13)15-11-17(7-8-18-15)9-14(10-17)21-2/h3-6,14-15,18H,7-11H2,1-2H3/t14?,15-,17?/m0/s1 |
| InChIKey | MEZVXKLVEQJPOZ-CKDBGZEDSA-N |
| XLogP | 3.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |