C27H29N3O4S — CID 178036595
1-methylsulfonyl-3-[1-(oxan-2-yl)-5-(oxan-3-yl)indazol-3-yl]isoquinoline (PubChem CID 178036595) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is 1-methylsulfonyl-3-[1-(oxan-2-yl)-5-(oxan-3-yl)indazol-3-yl]isoquinoline.
| Compound Name | 1-methylsulfonyl-3-[1-(oxan-2-yl)-5-(oxan-3-yl)indazol-3-yl]isoquinoline |
|---|---|
| PubChem CID | 178036595 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 1-methylsulfonyl-3-[1-(oxan-2-yl)-5-(oxan-3-yl)indazol-3-yl]isoquinoline |
| SMILES | CS(=O)(=O)c1nc(-c2nn(C3CCCCO3)c3ccc(C4CCCOC4)cc23)cc2ccccc12 |
| InChI | InChI=1S/C27H29N3O4S/c1-35(31,32)27-21-9-3-2-7-19(21)16-23(28-27)26-22-15-18(20-8-6-13-33-17-20)11-12-24(22)30(29-26)25-10-4-5-14-34-25/h2-3,7,9,11-12,15-16,20,25H,4-6,8,10,13-14,17H2,1H3 |
| InChIKey | BXQRSZSLLPETTI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |