C30H36N6O9S2 — CID 165127582
N-[(2S)-4-(2-hydroxyethoxy)butan-2-yl]-N-[3-(6-methyl-2-methylsulfonylpyrimidin-4-yl)-1-(oxan-2-yl)indazol-5-yl]-2-nitrobenzenesulfonamide (PubChem CID 165127582) has the molecular formula C30H36N6O9S2 and a molecular weight of 688.79 g/mol. Its IUPAC name is N-[(2S)-4-(2-hydroxyethoxy)butan-2-yl]-N-[3-(6-methyl-2-methylsulfonylpyrimidin-4-yl)-1-(oxan-2-yl)indazol-5-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(2S)-4-(2-hydroxyethoxy)butan-2-yl]-N-[3-(6-methyl-2-methylsulfonylpyrimidin-4-yl)-1-(oxan-2-yl)indazol-5-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 165127582 |
| Molecular Formula | C30H36N6O9S2 |
| Molecular Weight | 688.79 g/mol |
| Exact Mass | 688.20 |
| IUPAC Name | N-[(2S)-4-(2-hydroxyethoxy)butan-2-yl]-N-[3-(6-methyl-2-methylsulfonylpyrimidin-4-yl)-1-(oxan-2-yl)indazol-5-yl]-2-nitrobenzenesulfonamide |
| SMILES | Cc1cc(-c2nn(C3CCCCO3)c3ccc(N([C@@H](C)CCOCCO)S(=O)(=O)c4ccccc4[N+](=O)[O-])cc23)nc(S(C)(=O)=O)n1 |
| InChI | InChI=1S/C30H36N6O9S2/c1-20-18-24(32-30(31-20)46(3,40)41)29-23-19-22(11-12-25(23)34(33-29)28-10-6-7-15-45-28)35(21(2)13-16-44-17-14-37)47(42,43)27-9-5-4-8-26(27)36(38)39/h4-5,8-9,11-12,18-19,21,28,37H,6-7,10,13-17H2,1-3H3/t21-,28?/m0/s1 |
| InChIKey | PGSXJCOFGQUXAJ-QDLLFRBVSA-N |
| XLogP | 3.80 |
| TPSA | 196.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.79 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|