C28H39IN4O7SSi — CID 165127905
N-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethyl]-N-[3-iodo-1-(oxan-2-yl)indazol-5-yl]-2-nitrobenzenesulfonamide (PubChem CID 165127905) has the molecular formula C28H39IN4O7SSi and a molecular weight of 730.70 g/mol. Its IUPAC name is N-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethyl]-N-[3-iodo-1-(oxan-2-yl)indazol-5-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethyl]-N-[3-iodo-1-(oxan-2-yl)indazol-5-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 165127905 |
| Molecular Formula | C28H39IN4O7SSi |
| Molecular Weight | 730.70 g/mol |
| Exact Mass | 730.14 |
| IUPAC Name | N-[2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethyl]-N-[3-iodo-1-(oxan-2-yl)indazol-5-yl]-2-nitrobenzenesulfonamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCOCCN(c1ccc2c(c1)c(I)nn2C1CCCCO1)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H39IN4O7SSi/c1-28(2,3)42(4,5)40-19-18-38-17-15-31(41(36,37)25-11-7-6-10-24(25)33(34)35)21-13-14-23-22(20-21)27(29)30-32(23)26-12-8-9-16-39-26/h6-7,10-11,13-14,20,26H,8-9,12,15-19H2,1-5H3 |
| InChIKey | JKRQQDZHAZTSMN-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 126.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.70 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|