C25H32IN3O4 — CID 174203496
3-iodo-1-(oxan-2-yl)-5-[4-(3-phenylmethoxypropoxy)butan-2-yloxy]pyrazolo[3,4-c]pyridine (PubChem CID 174203496) has the molecular formula C25H32IN3O4 and a molecular weight of 565.45 g/mol. Its IUPAC name is 3-iodo-1-(oxan-2-yl)-5-[4-(3-phenylmethoxypropoxy)butan-2-yloxy]pyrazolo[3,4-c]pyridine.
| Compound Name | 3-iodo-1-(oxan-2-yl)-5-[4-(3-phenylmethoxypropoxy)butan-2-yloxy]pyrazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 174203496 |
| Molecular Formula | C25H32IN3O4 |
| Molecular Weight | 565.45 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | 3-iodo-1-(oxan-2-yl)-5-[4-(3-phenylmethoxypropoxy)butan-2-yloxy]pyrazolo[3,4-c]pyridine |
| SMILES | CC(CCOCCCOCc1ccccc1)Oc1cc2c(I)nn(C3CCCCO3)c2cn1 |
| InChI | InChI=1S/C25H32IN3O4/c1-19(11-15-30-12-7-13-31-18-20-8-3-2-4-9-20)33-23-16-21-22(17-27-23)29(28-25(21)26)24-10-5-6-14-32-24/h2-4,8-9,16-17,19,24H,5-7,10-15,18H2,1H3 |
| InChIKey | JLTOWUOTDSOSIW-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.45 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|