C20H28N2O3 — CID 174210532
4-methyl-6-[4-(3-phenylmethoxypropoxy)butan-2-yloxy]pyridin-3-amine (PubChem CID 174210532) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is 4-methyl-6-[4-(3-phenylmethoxypropoxy)butan-2-yloxy]pyridin-3-amine.
| Compound Name | 4-methyl-6-[4-(3-phenylmethoxypropoxy)butan-2-yloxy]pyridin-3-amine |
|---|---|
| PubChem CID | 174210532 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 4-methyl-6-[4-(3-phenylmethoxypropoxy)butan-2-yloxy]pyridin-3-amine |
| SMILES | Cc1cc(OC(C)CCOCCCOCc2ccccc2)ncc1N |
| InChI | InChI=1S/C20H28N2O3/c1-16-13-20(22-14-19(16)21)25-17(2)9-12-23-10-6-11-24-15-18-7-4-3-5-8-18/h3-5,7-8,13-14,17H,6,9-12,15,21H2,1-2H3 |
| InChIKey | RHADPTRKRJLVIZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|