C16H22BrN3O2 — CID 174203505
4-bromo-2-[3-(3-phenylmethoxybutoxy)propyl]triazole (PubChem CID 174203505) has the molecular formula C16H22BrN3O2 and a molecular weight of 368.28 g/mol. Its IUPAC name is 4-bromo-2-[3-(3-phenylmethoxybutoxy)propyl]triazole.
| Compound Name | 4-bromo-2-[3-(3-phenylmethoxybutoxy)propyl]triazole |
|---|---|
| PubChem CID | 174203505 |
| Molecular Formula | C16H22BrN3O2 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 4-bromo-2-[3-(3-phenylmethoxybutoxy)propyl]triazole |
| SMILES | CC(CCOCCCn1ncc(Br)n1)OCc1ccccc1 |
| InChI | InChI=1S/C16H22BrN3O2/c1-14(22-13-15-6-3-2-4-7-15)8-11-21-10-5-9-20-18-12-16(17)19-20/h2-4,6-7,12,14H,5,8-11,13H2,1H3 |
| InChIKey | CGOBXYHHNOHLPM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|