C15H24O5S — CID 174203688
4-(3-phenylmethoxypropoxy)pentane-1-sulfonic acid (PubChem CID 174203688) has the molecular formula C15H24O5S and a molecular weight of 316.42 g/mol. Its IUPAC name is 4-(3-phenylmethoxypropoxy)pentane-1-sulfonic acid.
| Compound Name | 4-(3-phenylmethoxypropoxy)pentane-1-sulfonic acid |
|---|---|
| PubChem CID | 174203688 |
| Molecular Formula | C15H24O5S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 4-(3-phenylmethoxypropoxy)pentane-1-sulfonic acid |
| SMILES | CC(CCCS(=O)(=O)O)OCCCOCc1ccccc1 |
| InChI | InChI=1S/C15H24O5S/c1-14(7-5-12-21(16,17)18)20-11-6-10-19-13-15-8-3-2-4-9-15/h2-4,8-9,14H,5-7,10-13H2,1H3,(H,16,17,18) |
| InChIKey | WCAUDQMGWHUPQL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|