C22H30N2O4 — CID 174204040
N-[4-methyl-6-[4-(3-phenylmethoxypropoxy)butan-2-yloxy]-3-pyridinyl]acetamide (PubChem CID 174204040) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is N-[4-methyl-6-[4-(3-phenylmethoxypropoxy)butan-2-yloxy]-3-pyridinyl]acetamide.
| Compound Name | N-[4-methyl-6-[4-(3-phenylmethoxypropoxy)butan-2-yloxy]-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 174204040 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | N-[4-methyl-6-[4-(3-phenylmethoxypropoxy)butan-2-yloxy]-3-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cnc(OC(C)CCOCCCOCc2ccccc2)cc1C |
| InChI | InChI=1S/C22H30N2O4/c1-17-14-22(23-15-21(17)24-19(3)25)28-18(2)10-13-26-11-7-12-27-16-20-8-5-4-6-9-20/h4-6,8-9,14-15,18H,7,10-13,16H2,1-3H3,(H,24,25) |
| InChIKey | QBUDXNUIWYGVPI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|