C22H27N3O4 — CID 165127489
1-[5-[(2R)-4-(3-phenylmethoxypropoxy)butan-2-yl]oxypyrazolo[3,4-c]pyridin-2-yl]ethanone (PubChem CID 165127489) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 1-[5-[(2R)-4-(3-phenylmethoxypropoxy)butan-2-yl]oxypyrazolo[3,4-c]pyridin-2-yl]ethanone.
| Compound Name | 1-[5-[(2R)-4-(3-phenylmethoxypropoxy)butan-2-yl]oxypyrazolo[3,4-c]pyridin-2-yl]ethanone |
|---|---|
| PubChem CID | 165127489 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 1-[5-[(2R)-4-(3-phenylmethoxypropoxy)butan-2-yl]oxypyrazolo[3,4-c]pyridin-2-yl]ethanone |
| SMILES | CC(=O)n1cc2cc(O[C@H](C)CCOCCCOCc3ccccc3)ncc2n1 |
| InChI | InChI=1S/C22H27N3O4/c1-17(9-12-27-10-6-11-28-16-19-7-4-3-5-8-19)29-22-13-20-15-25(18(2)26)24-21(20)14-23-22/h3-5,7-8,13-15,17H,6,9-12,16H2,1-2H3/t17-/m1/s1 |
| InChIKey | KESJFRNRFBXBNL-QGZVFWFLSA-N |
| XLogP | 3.87 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|