C28H28Cl2N4O7S — CID 165127597
N-[2-(2-chloroethoxy)ethyl]-N-[3-(3-chloro-5-hydroxyphenyl)-1-(oxan-2-yl)indazol-5-yl]-2-nitrobenzenesulfonamide (PubChem CID 165127597) has the molecular formula C28H28Cl2N4O7S and a molecular weight of 635.53 g/mol. Its IUPAC name is N-[2-(2-chloroethoxy)ethyl]-N-[3-(3-chloro-5-hydroxyphenyl)-1-(oxan-2-yl)indazol-5-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[2-(2-chloroethoxy)ethyl]-N-[3-(3-chloro-5-hydroxyphenyl)-1-(oxan-2-yl)indazol-5-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 165127597 |
| Molecular Formula | C28H28Cl2N4O7S |
| Molecular Weight | 635.53 g/mol |
| Exact Mass | 634.11 |
| IUPAC Name | N-[2-(2-chloroethoxy)ethyl]-N-[3-(3-chloro-5-hydroxyphenyl)-1-(oxan-2-yl)indazol-5-yl]-2-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)N(CCOCCCl)c1ccc2c(c1)c(-c1cc(O)cc(Cl)c1)nn2C1CCCCO1 |
| InChI | InChI=1S/C28H28Cl2N4O7S/c29-10-13-40-14-11-32(42(38,39)26-6-2-1-5-25(26)34(36)37)21-8-9-24-23(18-21)28(19-15-20(30)17-22(35)16-19)31-33(24)27-7-3-4-12-41-27/h1-2,5-6,8-9,15-18,27,35H,3-4,7,10-14H2 |
| InChIKey | BJWLCLIEKLFVLN-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 137.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.53 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|