C29H34N6O9S2 — CID 165127735
N-[(2S)-4-(2-hydroxyethoxy)butan-2-yl]-N-[3-(2-methylsulfonylpyrimidin-4-yl)-1-(oxan-2-yl)indazol-5-yl]-2-nitrobenzenesulfonamide (PubChem CID 165127735) has the molecular formula C29H34N6O9S2 and a molecular weight of 674.76 g/mol. Its IUPAC name is N-[(2S)-4-(2-hydroxyethoxy)butan-2-yl]-N-[3-(2-methylsulfonylpyrimidin-4-yl)-1-(oxan-2-yl)indazol-5-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(2S)-4-(2-hydroxyethoxy)butan-2-yl]-N-[3-(2-methylsulfonylpyrimidin-4-yl)-1-(oxan-2-yl)indazol-5-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 165127735 |
| Molecular Formula | C29H34N6O9S2 |
| Molecular Weight | 674.76 g/mol |
| Exact Mass | 674.18 |
| IUPAC Name | N-[(2S)-4-(2-hydroxyethoxy)butan-2-yl]-N-[3-(2-methylsulfonylpyrimidin-4-yl)-1-(oxan-2-yl)indazol-5-yl]-2-nitrobenzenesulfonamide |
| SMILES | C[C@@H](CCOCCO)N(c1ccc2c(c1)c(-c1ccnc(S(C)(=O)=O)n1)nn2C1CCCCO1)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H34N6O9S2/c1-20(13-17-43-18-15-36)34(46(41,42)26-8-4-3-7-25(26)35(37)38)21-10-11-24-22(19-21)28(32-33(24)27-9-5-6-16-44-27)23-12-14-30-29(31-23)45(2,39)40/h3-4,7-8,10-12,14,19-20,27,36H,5-6,9,13,15-18H2,1-2H3/t20-,27?/m0/s1 |
| InChIKey | FCIOLRAUDAKGQW-SVQMELKDSA-N |
| XLogP | 3.49 |
| TPSA | 196.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.76 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|