C16H15F2N7O4 — CID 178041828
4-(difluoromethyl)-5-(5-nitro-6-piperazin-1-yl-2-pyridinyl)-1,4-dihydropyrimido[4,5-d][1,3]oxazin-2-one (PubChem CID 178041828) has the molecular formula C16H15F2N7O4 and a molecular weight of 407.34 g/mol. Its IUPAC name is 4-(difluoromethyl)-5-(5-nitro-6-piperazin-1-yl-2-pyridinyl)-1,4-dihydropyrimido[4,5-d][1,3]oxazin-2-one.
| Compound Name | 4-(difluoromethyl)-5-(5-nitro-6-piperazin-1-yl-2-pyridinyl)-1,4-dihydropyrimido[4,5-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 178041828 |
| Molecular Formula | C16H15F2N7O4 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 4-(difluoromethyl)-5-(5-nitro-6-piperazin-1-yl-2-pyridinyl)-1,4-dihydropyrimido[4,5-d][1,3]oxazin-2-one |
| SMILES | O=C1Nc2ncnc(-c3ccc([N+](=O)[O-])c(N4CCNCC4)n3)c2C(C(F)F)O1 |
| InChI | InChI=1S/C16H15F2N7O4/c17-13(18)12-10-11(20-7-21-14(10)23-16(26)29-12)8-1-2-9(25(27)28)15(22-8)24-5-3-19-4-6-24/h1-2,7,12-13,19H,3-6H2,(H,20,21,23,26) |
| InChIKey | FWOCHPNVGNOTBI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|