C19H22N2O3S — CID 178047977
N-tert-butyl-4-(3-methyl-2-oxo-1H-indol-3-yl)benzenesulfonamide (PubChem CID 178047977) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is N-tert-butyl-4-(3-methyl-2-oxo-1H-indol-3-yl)benzenesulfonamide.
| Compound Name | N-tert-butyl-4-(3-methyl-2-oxo-1H-indol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 178047977 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-tert-butyl-4-(3-methyl-2-oxo-1H-indol-3-yl)benzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C2(C)C(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C19H22N2O3S/c1-18(2,3)21-25(23,24)14-11-9-13(10-12-14)19(4)15-7-5-6-8-16(15)20-17(19)22/h5-12,21H,1-4H3,(H,20,22) |
| InChIKey | MUHRHUSLXPBKMR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |