C17H27IN2O8P- — CID 178051988
CID 178051988 (PubChem CID 178051988) has the molecular formula C17H27IN2O8P- and a molecular weight of 545.29 g/mol.
| Compound Name | CID 178051988 |
|---|---|
| PubChem CID | 178051988 |
| Molecular Formula | C17H27IN2O8P- |
| Molecular Weight | 545.29 g/mol |
| Exact Mass | 545.06 |
| IUPAC Name | — |
| SMILES | CCOP(=O)(OCC)[C@@H]1[I-]C[C@H]1C[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C(OC)C1O |
| InChI | InChI=1S/C17H27IN2O8P/c1-4-26-29(24,27-5-2)15-10(9-18-15)8-11-13(22)14(25-3)16(28-11)20-7-6-12(21)19-17(20)23/h6-7,10-11,13-16,22H,4-5,8-9H2,1-3H3,(H,19,21,23)/q-1/t10-,11-,13?,14?,15+,16-/m1/s1 |
| InChIKey | KCOAFUGBVAKCMX-VFDCJNKZSA-N |
| XLogP | -2.49 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.29 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|