C11H10FN — CID 178060905
5-fluoro-6-phenyl-3,4-dihydropyridine (PubChem CID 178060905) has the molecular formula C11H10FN and a molecular weight of 175.21 g/mol. Its IUPAC name is 5-fluoro-6-phenyl-3,4-dihydropyridine.
| Compound Name | 5-fluoro-6-phenyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 178060905 |
| Molecular Formula | C11H10FN |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 5-fluoro-6-phenyl-3,4-dihydropyridine |
| SMILES | FC1=C(c2ccccc2)N=CCC1 |
| InChI | InChI=1S/C11H10FN/c12-10-7-4-8-13-11(10)9-5-2-1-3-6-9/h1-3,5-6,8H,4,7H2 |
| InChIKey | QHBJYIVHLIXXHO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |