C18H23BrFN3O4 — CID 178061372
tert-butyl N-[2-(5-bromo-6-methoxypyrimidin-4-yl)oxyethyl]carbamate;fluorobenzene (PubChem CID 178061372) has the molecular formula C18H23BrFN3O4 and a molecular weight of 444.30 g/mol. Its IUPAC name is tert-butyl N-[2-(5-bromo-6-methoxypyrimidin-4-yl)oxyethyl]carbamate;fluorobenzene.
| Compound Name | tert-butyl N-[2-(5-bromo-6-methoxypyrimidin-4-yl)oxyethyl]carbamate;fluorobenzene |
|---|---|
| PubChem CID | 178061372 |
| Molecular Formula | C18H23BrFN3O4 |
| Molecular Weight | 444.30 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | tert-butyl N-[2-(5-bromo-6-methoxypyrimidin-4-yl)oxyethyl]carbamate;fluorobenzene |
| SMILES | COc1ncnc(OCCNC(=O)OC(C)(C)C)c1Br.Fc1ccccc1 |
| InChI | InChI=1S/C12H18BrN3O4.C6H5F/c1-12(2,3)20-11(17)14-5-6-19-10-8(13)9(18-4)15-7-16-10;7-6-4-2-1-3-5-6/h7H,5-6H2,1-4H3,(H,14,17);1-5H |
| InChIKey | ZQVSGMCMPIXKJY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|