About 6-(2,9-diazaspiro[5.5]undecan-2-yl)-3-ethylhept-6-en-2-one;ethane;methane
6-(2,9-diazaspiro[5.5]undecan-2-yl)-3-ethylhept-6-en-2-one;ethane;methane (PubChem CID 178063045) has the molecular formula C21H42N2O
and a molecular weight of 338.58 g/mol. Its IUPAC name is 6-(2,9-diazaspiro[5.5]undecan-2-yl)-3-ethylhept-6-en-2-one;ethane;methane.
Molecular Properties
| Compound Name | 6-(2,9-diazaspiro[5.5]undecan-2-yl)-3-ethylhept-6-en-2-one;ethane;methane |
| PubChem CID | 178063045 |
| Molecular Formula | C21H42N2O |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.33 |
| IUPAC Name | 6-(2,9-diazaspiro[5.5]undecan-2-yl)-3-ethylhept-6-en-2-one;ethane;methane |
| SMILES | C.C=C(CCC(CC)C(C)=O)N1CCCC2(CCNCC2)C1.CC |
| InChI | InChI=1S/C18H32N2O.C2H6.CH4/c1-4-17(16(3)21)7-6-15(2)20-13-5-8-18(14-20)9-11-19-12-10-18;1-2;/h17,19H,2,4-14H2,1,3H3;1-2H3;1H4 |
| InChIKey | FKKHBKRSSKUVCY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(2,9-diazaspiro[5.5]undecan-2-yl)-3-ethylhept-6-en-2-one;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,9-diazaspiro[5.5]undecan-2-yl)-3-ethylhept-6-en-2-one;ethane;methane?
The IUPAC name of 6-(2,9-diazaspiro[5.5]undecan-2-yl)-3-ethylhept-6-en-2-one;ethane;methane (CID 178063045) is 6-(2,9-diazaspiro[5.5]undecan-2-yl)-3-ethylhept-6-en-2-one;ethane;methane.
What is the SMILES notation for 6-(2,9-diazaspiro[5.5]undecan-2-yl)-3-ethylhept-6-en-2-one;ethane;methane?
The canonical SMILES for 6-(2,9-diazaspiro[5.5]undecan-2-yl)-3-ethylhept-6-en-2-one;ethane;methane is C.C=C(CCC(CC)C(C)=O)N1CCCC2(CCNCC2)C1.CC.
What is the InChIKey of 6-(2,9-diazaspiro[5.5]undecan-2-yl)-3-ethylhept-6-en-2-one;ethane;methane?
The InChIKey is FKKHBKRSSKUVCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2O.C2H6.CH4/c1-4-17(16(3)21)7-6-15(2)20-13-5-8-18(14-20)9-11-19-12-10-18;1-2;/h17,19H,2,4-14H2,1,3H3;1-2H3;1H4.
What are the key properties of 6-(2,9-diazaspiro[5.5]undecan-2-yl)-3-ethylhept-6-en-2-one;ethane;methane?
6-(2,9-diazaspiro[5.5]undecan-2-yl)-3-ethylhept-6-en-2-one;ethane;methane has a molecular weight of 338.58 g/mol, XLogP of 5.02, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,9-diazaspiro[5.5]undecan-2-yl)-3-ethylhept-6-en-2-one;ethane;methane is sourced from PubChem (CID 178063045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).