C11H18BNO4 — CID 178066328
[6-(3,3-dimethylbutoxy)-2-pyridinyl]oxyboronic acid (PubChem CID 178066328) has the molecular formula C11H18BNO4 and a molecular weight of 239.08 g/mol. Its IUPAC name is [6-(3,3-dimethylbutoxy)-2-pyridinyl]oxyboronic acid.
| Compound Name | [6-(3,3-dimethylbutoxy)-2-pyridinyl]oxyboronic acid |
|---|---|
| PubChem CID | 178066328 |
| Molecular Formula | C11H18BNO4 |
| Molecular Weight | 239.08 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | [6-(3,3-dimethylbutoxy)-2-pyridinyl]oxyboronic acid |
| SMILES | CC(C)(C)CCOc1cccc(OB(O)O)n1 |
| InChI | InChI=1S/C11H18BNO4/c1-11(2,3)7-8-16-9-5-4-6-10(13-9)17-12(14)15/h4-6,14-15H,7-8H2,1-3H3 |
| InChIKey | FVFRDDFKAHYELI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.08 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|