C17H24FN3O3S2 — CID 178069550
5-[(7R)-1-fluoro-3-hydroxy-7-(3-methylbutylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidine-3-thione (PubChem CID 178069550) has the molecular formula C17H24FN3O3S2 and a molecular weight of 401.53 g/mol. Its IUPAC name is 5-[(7R)-1-fluoro-3-hydroxy-7-(3-methylbutylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidine-3-thione.
| Compound Name | 5-[(7R)-1-fluoro-3-hydroxy-7-(3-methylbutylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidine-3-thione |
|---|---|
| PubChem CID | 178069550 |
| Molecular Formula | C17H24FN3O3S2 |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 5-[(7R)-1-fluoro-3-hydroxy-7-(3-methylbutylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidine-3-thione |
| SMILES | CC(C)CCN[C@@H]1CCc2cc(O)c(N3CC(=S)NS3(=O)=O)c(F)c2C1 |
| InChI | InChI=1S/C17H24FN3O3S2/c1-10(2)5-6-19-12-4-3-11-7-14(22)17(16(18)13(11)8-12)21-9-15(25)20-26(21,23)24/h7,10,12,19,22H,3-6,8-9H2,1-2H3,(H,20,25)/t12-/m1/s1 |
| InChIKey | YEBCAOJPSLOJML-GFCCVEGCSA-N |
| XLogP | 2.01 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|