C26H28F2N2 — CID 178070473
4,4-bis(4-fluorophenyl)-N-[[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]butan-1-amine (PubChem CID 178070473) has the molecular formula C26H28F2N2 and a molecular weight of 406.52 g/mol. Its IUPAC name is 4,4-bis(4-fluorophenyl)-N-[[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]butan-1-amine.
| Compound Name | 4,4-bis(4-fluorophenyl)-N-[[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 178070473 |
| Molecular Formula | C26H28F2N2 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 4,4-bis(4-fluorophenyl)-N-[[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]butan-1-amine |
| SMILES | Fc1ccc(C(CCCNC[C@@H]2Cc3ccccc3CN2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H28F2N2/c27-23-11-7-19(8-12-23)26(20-9-13-24(28)14-10-20)6-3-15-29-18-25-16-21-4-1-2-5-22(21)17-30-25/h1-2,4-5,7-14,25-26,29-30H,3,6,15-18H2/t25-/m0/s1 |
| InChIKey | IKCXAHGJQPYZNI-VWLOTQADSA-N |
| XLogP | 5.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|