C14H22Cl3N3 — CID 178074870
N'-[2-(3-chloroanilino)ethyl]-N,N'-bis(2-chloroethyl)ethane-1,2-diamine (PubChem CID 178074870) has the molecular formula C14H22Cl3N3 and a molecular weight of 338.71 g/mol. Its IUPAC name is N'-[2-(3-chloroanilino)ethyl]-N,N'-bis(2-chloroethyl)ethane-1,2-diamine.
| Compound Name | N'-[2-(3-chloroanilino)ethyl]-N,N'-bis(2-chloroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 178074870 |
| Molecular Formula | C14H22Cl3N3 |
| Molecular Weight | 338.71 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N'-[2-(3-chloroanilino)ethyl]-N,N'-bis(2-chloroethyl)ethane-1,2-diamine |
| SMILES | ClCCNCCN(CCCl)CCNc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H22Cl3N3/c15-4-6-18-7-10-20(9-5-16)11-8-19-14-3-1-2-13(17)12-14/h1-3,12,18-19H,4-11H2 |
| InChIKey | HSVWALJYRIEWNC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.71 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|