C20H24B2N6O2 — CID 178083677
CID 178083677 (PubChem CID 178083677) has the molecular formula C20H24B2N6O2 and a molecular weight of 402.08 g/mol.
| Compound Name | CID 178083677 |
|---|---|
| PubChem CID | 178083677 |
| Molecular Formula | C20H24B2N6O2 |
| Molecular Weight | 402.08 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1[C@H]([B])C2(CCC13CC3)NC(=O)/C(=C(C)/C=C(\C)Nc1cc(N)ncn1)N2C=O |
| InChI | InChI=1S/C20H24B2N6O2/c1-11(7-12(2)26-14-8-13(23)24-9-25-14)15-18(30)27-20(28(15)10-29)6-5-19(3-4-19)16(21)17(20)22/h7-10,16-17H,3-6H2,1-2H3,(H,27,30)(H3,23,24,25,26)/b12-7+,15-11-/t16-,17+,20?/m1/s1 |
| InChIKey | KGWZKXMIOOQRIL-IYZBLVMHSA-N |
| XLogP | 1.42 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.08 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|