C17H24O6 — CID 178085868
(2S,3S,4R,6S)-6-(5-ethyl-3,3-dimethylcyclohepta-1,4,6-trien-1-yl)oxy-3,4-dihydroxyoxane-2-carboxylic acid (PubChem CID 178085868) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is (2S,3S,4R,6S)-6-(5-ethyl-3,3-dimethylcyclohepta-1,4,6-trien-1-yl)oxy-3,4-dihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4R,6S)-6-(5-ethyl-3,3-dimethylcyclohepta-1,4,6-trien-1-yl)oxy-3,4-dihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 178085868 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (2S,3S,4R,6S)-6-(5-ethyl-3,3-dimethylcyclohepta-1,4,6-trien-1-yl)oxy-3,4-dihydroxyoxane-2-carboxylic acid |
| SMILES | CCC1=CC(C)(C)C=C(O[C@H]2C[C@@H](O)[C@H](O)[C@@H](C(=O)O)O2)C=C1 |
| InChI | InChI=1S/C17H24O6/c1-4-10-5-6-11(9-17(2,3)8-10)22-13-7-12(18)14(19)15(23-13)16(20)21/h5-6,8-9,12-15,18-19H,4,7H2,1-3H3,(H,20,21)/t12-,13-,14+,15+/m1/s1 |
| InChIKey | WOEPITNPKOPNOI-KBXIAJHMSA-N |
| XLogP | 1.74 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |