C21H36FNO2 — CID 178088292
ethane;(2Z,4Z)-N-ethyl-2-(4-fluorophenyl)-6-methylhepta-2,4-dien-3-amine;formic acid (PubChem CID 178088292) has the molecular formula C21H36FNO2 and a molecular weight of 353.52 g/mol. Its IUPAC name is ethane;(2Z,4Z)-N-ethyl-2-(4-fluorophenyl)-6-methylhepta-2,4-dien-3-amine;formic acid.
| Compound Name | ethane;(2Z,4Z)-N-ethyl-2-(4-fluorophenyl)-6-methylhepta-2,4-dien-3-amine;formic acid |
|---|---|
| PubChem CID | 178088292 |
| Molecular Formula | C21H36FNO2 |
| Molecular Weight | 353.52 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | ethane;(2Z,4Z)-N-ethyl-2-(4-fluorophenyl)-6-methylhepta-2,4-dien-3-amine;formic acid |
| SMILES | CC.CC.CCNC(/C=C\C(C)C)=C(/C)c1ccc(F)cc1.O=CO |
| InChI | InChI=1S/C16H22FN.2C2H6.CH2O2/c1-5-18-16(11-6-12(2)3)13(4)14-7-9-15(17)10-8-14;2*1-2;2-1-3/h6-12,18H,5H2,1-4H3;2*1-2H3;1H,(H,2,3)/b11-6-,16-13-;;; |
| InChIKey | ICZKFNZQMGAZCT-RAPQFDCSSA-N |
| XLogP | 6.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|