C28H38N6O3 — CID 178089005
7-[3-[[[2-(tert-butylamino)quinolin-7-yl]amino]methyl]cyclopentyl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;propane-2,2-diol (PubChem CID 178089005) has the molecular formula C28H38N6O3 and a molecular weight of 506.65 g/mol. Its IUPAC name is 7-[3-[[[2-(tert-butylamino)quinolin-7-yl]amino]methyl]cyclopentyl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;propane-2,2-diol.
| Compound Name | 7-[3-[[[2-(tert-butylamino)quinolin-7-yl]amino]methyl]cyclopentyl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;propane-2,2-diol |
|---|---|
| PubChem CID | 178089005 |
| Molecular Formula | C28H38N6O3 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | 7-[3-[[[2-(tert-butylamino)quinolin-7-yl]amino]methyl]cyclopentyl]-3H-pyrrolo[2,3-d]pyrimidin-4-one;propane-2,2-diol |
| SMILES | CC(C)(C)Nc1ccc2ccc(NCC3CCC(n4ccc5c(=O)[nH]cnc54)C3)cc2n1.CC(C)(O)O |
| InChI | InChI=1S/C25H30N6O.C3H8O2/c1-25(2,3)30-22-9-6-17-5-7-18(13-21(17)29-22)26-14-16-4-8-19(12-16)31-11-10-20-23(31)27-15-28-24(20)32;1-3(2,4)5/h5-7,9-11,13,15-16,19,26H,4,8,12,14H2,1-3H3,(H,29,30)(H,27,28,32);4-5H,1-2H3 |
| InChIKey | SLFCDTSDRFDMAZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 128.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|