C43H79NO — CID 178090029
(6Z,9Z,28Z,31Z)-19-[1-(butylamino)ethenyl]heptatriaconta-6,9,28,31-tetraen-19-ol (PubChem CID 178090029) has the molecular formula C43H79NO and a molecular weight of 626.11 g/mol. Its IUPAC name is (6Z,9Z,28Z,31Z)-19-[1-(butylamino)ethenyl]heptatriaconta-6,9,28,31-tetraen-19-ol.
| Compound Name | (6Z,9Z,28Z,31Z)-19-[1-(butylamino)ethenyl]heptatriaconta-6,9,28,31-tetraen-19-ol |
|---|---|
| PubChem CID | 178090029 |
| Molecular Formula | C43H79NO |
| Molecular Weight | 626.11 g/mol |
| Exact Mass | 625.62 |
| IUPAC Name | (6Z,9Z,28Z,31Z)-19-[1-(butylamino)ethenyl]heptatriaconta-6,9,28,31-tetraen-19-ol |
| SMILES | C=C(NCCCC)C(O)(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C43H79NO/c1-5-8-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-43(45,42(4)44-41-10-7-3)40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-9-6-2/h15-18,21-24,44-45H,4-14,19-20,25-41H2,1-3H3/b17-15-,18-16-,23-21-,24-22- |
| InChIKey | RIIZXBWFQJYYNU-MLLZQYMOSA-N |
| XLogP | 14.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.11 |
| LogP ≤ 5 | 14.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|