C16H9F4N3O3 — CID 178090545
6-[2-fluoro-5-(trifluoromethyl)anilino]-7-methoxyquinoxaline-5,8-dione (PubChem CID 178090545) has the molecular formula C16H9F4N3O3 and a molecular weight of 367.26 g/mol. Its IUPAC name is 6-[2-fluoro-5-(trifluoromethyl)anilino]-7-methoxyquinoxaline-5,8-dione.
| Compound Name | 6-[2-fluoro-5-(trifluoromethyl)anilino]-7-methoxyquinoxaline-5,8-dione |
|---|---|
| PubChem CID | 178090545 |
| Molecular Formula | C16H9F4N3O3 |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 6-[2-fluoro-5-(trifluoromethyl)anilino]-7-methoxyquinoxaline-5,8-dione |
| SMILES | COC1=C(Nc2cc(C(F)(F)F)ccc2F)C(=O)c2nccnc2C1=O |
| InChI | InChI=1S/C16H9F4N3O3/c1-26-15-12(13(24)10-11(14(15)25)22-5-4-21-10)23-9-6-7(16(18,19)20)2-3-8(9)17/h2-6,23H,1H3 |
| InChIKey | PBTBAZYVHPFXCN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|