C19H29N3O2 — CID 178092260
tert-butyl 2-[(E)-1-[1-(butan-2-ylideneamino)ethylideneamino]but-1-enyl]pyrrole-1-carboxylate (PubChem CID 178092260) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is tert-butyl 2-[(E)-1-[1-(butan-2-ylideneamino)ethylideneamino]but-1-enyl]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-[(E)-1-[1-(butan-2-ylideneamino)ethylideneamino]but-1-enyl]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 178092260 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | tert-butyl 2-[(E)-1-[1-(butan-2-ylideneamino)ethylideneamino]but-1-enyl]pyrrole-1-carboxylate |
| SMILES | CC/C=C(/N=C(C)/N=C(\C)CC)c1cccn1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29N3O2/c1-8-11-16(21-15(4)20-14(3)9-2)17-12-10-13-22(17)18(23)24-19(5,6)7/h10-13H,8-9H2,1-7H3/b16-11+,20-14+,21-15+ |
| InChIKey | QCVACZYUOJWPSP-JUXOBYMSSA-N |
| XLogP | 5.31 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|