C20H28F2N2O2 — CID 178091913
tert-butyl 2-[(3Z)-5,5-difluoro-4-(3-methylpentan-2-ylideneamino)penta-1,3-dien-2-yl]pyrrole-1-carboxylate (PubChem CID 178091913) has the molecular formula C20H28F2N2O2 and a molecular weight of 366.45 g/mol. Its IUPAC name is tert-butyl 2-[(3Z)-5,5-difluoro-4-(3-methylpentan-2-ylideneamino)penta-1,3-dien-2-yl]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-[(3Z)-5,5-difluoro-4-(3-methylpentan-2-ylideneamino)penta-1,3-dien-2-yl]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 178091913 |
| Molecular Formula | C20H28F2N2O2 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | tert-butyl 2-[(3Z)-5,5-difluoro-4-(3-methylpentan-2-ylideneamino)penta-1,3-dien-2-yl]pyrrole-1-carboxylate |
| SMILES | C=C(/C=C(\N=C(/C)C(C)CC)C(F)F)c1cccn1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H28F2N2O2/c1-8-13(2)15(4)23-16(18(21)22)12-14(3)17-10-9-11-24(17)19(25)26-20(5,6)7/h9-13,18H,3,8H2,1-2,4-7H3/b16-12-,23-15+ |
| InChIKey | VDHOCLDLFQFBOJ-WFWDJGDQSA-N |
| XLogP | 5.94 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|