C14H22FN3O4 — CID 178095613
3-(5-acetamido-6-fluoro-3-methoxy-4-methyl-2-pyridinyl)-2-aminopropanoic acid;ethane (PubChem CID 178095613) has the molecular formula C14H22FN3O4 and a molecular weight of 315.35 g/mol. Its IUPAC name is 3-(5-acetamido-6-fluoro-3-methoxy-4-methyl-2-pyridinyl)-2-aminopropanoic acid;ethane.
| Compound Name | 3-(5-acetamido-6-fluoro-3-methoxy-4-methyl-2-pyridinyl)-2-aminopropanoic acid;ethane |
|---|---|
| PubChem CID | 178095613 |
| Molecular Formula | C14H22FN3O4 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 3-(5-acetamido-6-fluoro-3-methoxy-4-methyl-2-pyridinyl)-2-aminopropanoic acid;ethane |
| SMILES | CC.COc1c(CC(N)C(=O)O)nc(F)c(NC(C)=O)c1C |
| InChI | InChI=1S/C12H16FN3O4.C2H6/c1-5-9(15-6(2)17)11(13)16-8(10(5)20-3)4-7(14)12(18)19;1-2/h7H,4,14H2,1-3H3,(H,15,17)(H,18,19);1-2H3 |
| InChIKey | NSACHUKWNVUOAK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|