C13H16AlF2N2O4 — CID 178095883
CID 178095883 (PubChem CID 178095883) has the molecular formula C13H16AlF2N2O4 and a molecular weight of 329.26 g/mol.
| Compound Name | CID 178095883 |
|---|---|
| PubChem CID | 178095883 |
| Molecular Formula | C13H16AlF2N2O4 |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | — |
| SMILES | COc1c(F)c(CC(N)C(=O)O)c(NC(C)=O)c([Al]C)c1F |
| InChI | InChI=1S/C12H13F2N2O4.CH3.Al/c1-5(17)16-9-4-7(13)11(20-2)10(14)6(9)3-8(15)12(18)19;;/h8H,3,15H2,1-2H3,(H,16,17)(H,18,19);1H3; |
| InChIKey | PBYKJALZDFARHP-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |