C14H13F8NO4 — CID 178095642
2-amino-3-[2,4-difluoro-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-methoxy-5-methylphenyl]propanoic acid (PubChem CID 178095642) has the molecular formula C14H13F8NO4 and a molecular weight of 411.25 g/mol. Its IUPAC name is 2-amino-3-[2,4-difluoro-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-methoxy-5-methylphenyl]propanoic acid.
| Compound Name | 2-amino-3-[2,4-difluoro-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-methoxy-5-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 178095642 |
| Molecular Formula | C14H13F8NO4 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 2-amino-3-[2,4-difluoro-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3-methoxy-5-methylphenyl]propanoic acid |
| SMILES | COc1c(F)c(C)c(C(O)(C(F)(F)F)C(F)(F)F)c(CC(N)C(=O)O)c1F |
| InChI | InChI=1S/C14H13F8NO4/c1-4-7(12(26,13(17,18)19)14(20,21)22)5(3-6(23)11(24)25)9(16)10(27-2)8(4)15/h6,26H,3,23H2,1-2H3,(H,24,25) |
| InChIKey | MTUIDUCXCDSHBG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |