C13H12F7NO3 — CID 178095923
2-amino-3-[5-fluoro-3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenyl]propanoic acid (PubChem CID 178095923) has the molecular formula C13H12F7NO3 and a molecular weight of 363.23 g/mol. Its IUPAC name is 2-amino-3-[5-fluoro-3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenyl]propanoic acid.
| Compound Name | 2-amino-3-[5-fluoro-3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 178095923 |
| Molecular Formula | C13H12F7NO3 |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-amino-3-[5-fluoro-3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenyl]propanoic acid |
| SMILES | Cc1c(CC(N)C(=O)O)cc(F)cc1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H12F7NO3/c1-5-6(3-9(21)10(22)23)2-7(14)4-8(5)11(24,12(15,16)17)13(18,19)20/h2,4,9,24H,3,21H2,1H3,(H,22,23) |
| InChIKey | ZZDSFMDBUJBDLK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |