C10H18N2O2 — CID 178099043
5,7-diethyl-2-oxa-5,7-diazaspiro[3.5]nonan-6-one (PubChem CID 178099043) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 5,7-diethyl-2-oxa-5,7-diazaspiro[3.5]nonan-6-one.
| Compound Name | 5,7-diethyl-2-oxa-5,7-diazaspiro[3.5]nonan-6-one |
|---|---|
| PubChem CID | 178099043 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 5,7-diethyl-2-oxa-5,7-diazaspiro[3.5]nonan-6-one |
| SMILES | CCN1CCC2(COC2)N(CC)C1=O |
| InChI | InChI=1S/C10H18N2O2/c1-3-11-6-5-10(7-14-8-10)12(4-2)9(11)13/h3-8H2,1-2H3 |
| InChIKey | BEJZVHCZEBOWOZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |