C13H24FN — CID 178101491
(3S)-1-ethyl-4-(fluoromethyl)-3-methyl-3-(2-methylprop-2-enyl)piperidine (PubChem CID 178101491) has the molecular formula C13H24FN and a molecular weight of 213.34 g/mol. Its IUPAC name is (3S)-1-ethyl-4-(fluoromethyl)-3-methyl-3-(2-methylprop-2-enyl)piperidine.
| Compound Name | (3S)-1-ethyl-4-(fluoromethyl)-3-methyl-3-(2-methylprop-2-enyl)piperidine |
|---|---|
| PubChem CID | 178101491 |
| Molecular Formula | C13H24FN |
| Molecular Weight | 213.34 g/mol |
| Exact Mass | 213.19 |
| IUPAC Name | (3S)-1-ethyl-4-(fluoromethyl)-3-methyl-3-(2-methylprop-2-enyl)piperidine |
| SMILES | C=C(C)C[C@]1(C)CN(CC)CCC1CF |
| InChI | InChI=1S/C13H24FN/c1-5-15-7-6-12(9-14)13(4,10-15)8-11(2)3/h12H,2,5-10H2,1,3-4H3/t12?,13-/m1/s1 |
| InChIKey | NRWDMVIOSYIRED-ZGTCLIOFSA-N |
| XLogP | 3.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|