C15H27F2N — CID 154670349
10,10-difluoro-3-methylidene-8-propyl-8-azaspiro[4.5]decane;ethane (PubChem CID 154670349) has the molecular formula C15H27F2N and a molecular weight of 259.38 g/mol. Its IUPAC name is 10,10-difluoro-3-methylidene-8-propyl-8-azaspiro[4.5]decane;ethane.
| Compound Name | 10,10-difluoro-3-methylidene-8-propyl-8-azaspiro[4.5]decane;ethane |
|---|---|
| PubChem CID | 154670349 |
| Molecular Formula | C15H27F2N |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | 10,10-difluoro-3-methylidene-8-propyl-8-azaspiro[4.5]decane;ethane |
| SMILES | C=C1CCC2(CCN(CCC)CC2(F)F)C1.CC |
| InChI | InChI=1S/C13H21F2N.C2H6/c1-3-7-16-8-6-12(13(14,15)10-16)5-4-11(2)9-12;1-2/h2-10H2,1H3;1-2H3 |
| InChIKey | GTUHHQZLERXHSA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|