C12H18F5N — CID 177030667
1-(2,2-difluoro-3-methylbut-3-enyl)-4-methyl-4-(trifluoromethyl)piperidine (PubChem CID 177030667) has the molecular formula C12H18F5N and a molecular weight of 271.27 g/mol. Its IUPAC name is 1-(2,2-difluoro-3-methylbut-3-enyl)-4-methyl-4-(trifluoromethyl)piperidine.
| Compound Name | 1-(2,2-difluoro-3-methylbut-3-enyl)-4-methyl-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 177030667 |
| Molecular Formula | C12H18F5N |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-(2,2-difluoro-3-methylbut-3-enyl)-4-methyl-4-(trifluoromethyl)piperidine |
| SMILES | C=C(C)C(F)(F)CN1CCC(C)(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H18F5N/c1-9(2)11(13,14)8-18-6-4-10(3,5-7-18)12(15,16)17/h1,4-8H2,2-3H3 |
| InChIKey | OQVQUVIXFQMTLB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|