C15H26F3N — CID 177031700
4-(1,1-difluoropropyl)-1-(2-fluorobutyl)-4-prop-1-en-2-ylpiperidine (PubChem CID 177031700) has the molecular formula C15H26F3N and a molecular weight of 277.37 g/mol. Its IUPAC name is 4-(1,1-difluoropropyl)-1-(2-fluorobutyl)-4-prop-1-en-2-ylpiperidine.
| Compound Name | 4-(1,1-difluoropropyl)-1-(2-fluorobutyl)-4-prop-1-en-2-ylpiperidine |
|---|---|
| PubChem CID | 177031700 |
| Molecular Formula | C15H26F3N |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 4-(1,1-difluoropropyl)-1-(2-fluorobutyl)-4-prop-1-en-2-ylpiperidine |
| SMILES | C=C(C)C1(C(F)(F)CC)CCN(CC(F)CC)CC1 |
| InChI | InChI=1S/C15H26F3N/c1-5-13(16)11-19-9-7-14(8-10-19,12(3)4)15(17,18)6-2/h13H,3,5-11H2,1-2,4H3 |
| InChIKey | BVIMXFPVHXHHRC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|