C13H18BrN3O3 — CID 178109140
tert-butyl N-[4-bromo-N-(methylcarbamoyl)anilino]carbamate (PubChem CID 178109140) has the molecular formula C13H18BrN3O3 and a molecular weight of 344.21 g/mol. Its IUPAC name is tert-butyl N-[4-bromo-N-(methylcarbamoyl)anilino]carbamate.
| Compound Name | tert-butyl N-[4-bromo-N-(methylcarbamoyl)anilino]carbamate |
|---|---|
| PubChem CID | 178109140 |
| Molecular Formula | C13H18BrN3O3 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | tert-butyl N-[4-bromo-N-(methylcarbamoyl)anilino]carbamate |
| SMILES | CNC(=O)N(NC(=O)OC(C)(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H18BrN3O3/c1-13(2,3)20-12(19)16-17(11(18)15-4)10-7-5-9(14)6-8-10/h5-8H,1-4H3,(H,15,18)(H,16,19) |
| InChIKey | SOMXFXLIEDDMRI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|