C25H29ClFN3O4 — CID 178109865
methyl 2-[[(2S)-2-(4-chlorophenoxy)-3-cyclopropylpropanoyl]amino]-5-[(3S)-4-fluoro-3-methylpiperazin-1-yl]benzoate (PubChem CID 178109865) has the molecular formula C25H29ClFN3O4 and a molecular weight of 489.98 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-(4-chlorophenoxy)-3-cyclopropylpropanoyl]amino]-5-[(3S)-4-fluoro-3-methylpiperazin-1-yl]benzoate.
| Compound Name | methyl 2-[[(2S)-2-(4-chlorophenoxy)-3-cyclopropylpropanoyl]amino]-5-[(3S)-4-fluoro-3-methylpiperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 178109865 |
| Molecular Formula | C25H29ClFN3O4 |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | methyl 2-[[(2S)-2-(4-chlorophenoxy)-3-cyclopropylpropanoyl]amino]-5-[(3S)-4-fluoro-3-methylpiperazin-1-yl]benzoate |
| SMILES | COC(=O)c1cc(N2CCN(F)[C@@H](C)C2)ccc1NC(=O)[C@H](CC1CC1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H29ClFN3O4/c1-16-15-29(11-12-30(16)27)19-7-10-22(21(14-19)25(32)33-2)28-24(31)23(13-17-3-4-17)34-20-8-5-18(26)6-9-20/h5-10,14,16-17,23H,3-4,11-13,15H2,1-2H3,(H,28,31)/t16-,23-/m0/s1 |
| InChIKey | JELMVRCZSLPXSP-HJPURHCSSA-N |
| XLogP | 4.71 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|