C17H18N4O2 — CID 178110878
7-(3-methoxy-2,6-dimethylanilino)-3-methylimidazo[4,5-b]pyridine-5-carbaldehyde (PubChem CID 178110878) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 7-(3-methoxy-2,6-dimethylanilino)-3-methylimidazo[4,5-b]pyridine-5-carbaldehyde.
| Compound Name | 7-(3-methoxy-2,6-dimethylanilino)-3-methylimidazo[4,5-b]pyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 178110878 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 7-(3-methoxy-2,6-dimethylanilino)-3-methylimidazo[4,5-b]pyridine-5-carbaldehyde |
| SMILES | COc1ccc(C)c(Nc2cc(C=O)nc3c2ncn3C)c1C |
| InChI | InChI=1S/C17H18N4O2/c1-10-5-6-14(23-4)11(2)15(10)20-13-7-12(8-22)19-17-16(13)18-9-21(17)3/h5-9H,1-4H3,(H,19,20) |
| InChIKey | LRLSJMIOKJPUAK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|