C16H16BrClN4O — CID 178111219
6-bromo-5-chloro-N-(3-methoxy-2,6-dimethylphenyl)-3-methylimidazo[4,5-b]pyridin-7-amine (PubChem CID 178111219) has the molecular formula C16H16BrClN4O and a molecular weight of 395.69 g/mol. Its IUPAC name is 6-bromo-5-chloro-N-(3-methoxy-2,6-dimethylphenyl)-3-methylimidazo[4,5-b]pyridin-7-amine.
| Compound Name | 6-bromo-5-chloro-N-(3-methoxy-2,6-dimethylphenyl)-3-methylimidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 178111219 |
| Molecular Formula | C16H16BrClN4O |
| Molecular Weight | 395.69 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 6-bromo-5-chloro-N-(3-methoxy-2,6-dimethylphenyl)-3-methylimidazo[4,5-b]pyridin-7-amine |
| SMILES | COc1ccc(C)c(Nc2c(Br)c(Cl)nc3c2ncn3C)c1C |
| InChI | InChI=1S/C16H16BrClN4O/c1-8-5-6-10(23-4)9(2)12(8)20-13-11(17)15(18)21-16-14(13)19-7-22(16)3/h5-7H,1-4H3,(H,20,21) |
| InChIKey | SUWOVFWDLPYUEE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.69 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|