C24H27BrN6O4 — CID 178110888
tert-butyl N-[8-bromo-10-carbamoyl-12-(3-methoxy-2,6-dimethylphenyl)-5-methyl-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-11-yl]carbamate (PubChem CID 178110888) has the molecular formula C24H27BrN6O4 and a molecular weight of 543.42 g/mol. Its IUPAC name is tert-butyl N-[8-bromo-10-carbamoyl-12-(3-methoxy-2,6-dimethylphenyl)-5-methyl-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-11-yl]carbamate.
| Compound Name | tert-butyl N-[8-bromo-10-carbamoyl-12-(3-methoxy-2,6-dimethylphenyl)-5-methyl-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-11-yl]carbamate |
|---|---|
| PubChem CID | 178110888 |
| Molecular Formula | C24H27BrN6O4 |
| Molecular Weight | 543.42 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | tert-butyl N-[8-bromo-10-carbamoyl-12-(3-methoxy-2,6-dimethylphenyl)-5-methyl-3,5,7,12-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),3,7,10-pentaen-11-yl]carbamate |
| SMILES | COc1ccc(C)c(-n2c(NC(=O)OC(C)(C)C)c(C(N)=O)c3c(Br)nc4c(ncn4C)c32)c1C |
| InChI | InChI=1S/C24H27BrN6O4/c1-11-8-9-13(34-7)12(2)17(11)31-18-14(19(25)28-22-16(18)27-10-30(22)6)15(20(26)32)21(31)29-23(33)35-24(3,4)5/h8-10H,1-7H3,(H2,26,32)(H,29,33) |
| InChIKey | UPNAOUGAUYSCMB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|