C26H30N2O6RfS2 — CID 178113034
(2E)-2-[(2E,4E)-5-(3,3-dimethyl-5-sulfo-4,5-dihydroindol-2-yl)penta-2,4-dienylidene]-1,3,3-trimethylindole-5-sulfonic acid;rutherfordium (PubChem CID 178113034) has the molecular formula C26H30N2O6RfS2 and a molecular weight of 797.67 g/mol. Its IUPAC name is (2E)-2-[(2E,4E)-5-(3,3-dimethyl-5-sulfo-4,5-dihydroindol-2-yl)penta-2,4-dienylidene]-1,3,3-trimethylindole-5-sulfonic acid;rutherfordium.
| Compound Name | (2E)-2-[(2E,4E)-5-(3,3-dimethyl-5-sulfo-4,5-dihydroindol-2-yl)penta-2,4-dienylidene]-1,3,3-trimethylindole-5-sulfonic acid;rutherfordium |
|---|---|
| PubChem CID | 178113034 |
| Molecular Formula | C26H30N2O6RfS2 |
| Molecular Weight | 797.67 g/mol |
| Exact Mass | 797.28 |
| IUPAC Name | (2E)-2-[(2E,4E)-5-(3,3-dimethyl-5-sulfo-4,5-dihydroindol-2-yl)penta-2,4-dienylidene]-1,3,3-trimethylindole-5-sulfonic acid;rutherfordium |
| SMILES | CN1/C(=C/C=C/C=C/C2=NC3=C(CC(S(=O)(=O)O)C=C3)C2(C)C)C(C)(C)c2cc(S(=O)(=O)O)ccc21.[Rf] |
| InChI | InChI=1S/C26H30N2O6S2.Rf/c1-25(2)19-15-17(35(29,30)31)11-13-21(19)27-23(25)9-7-6-8-10-24-26(3,4)20-16-18(36(32,33)34)12-14-22(20)28(24)5;/h6-14,16-17H,15H2,1-5H3,(H,29,30,31)(H,32,33,34);/b8-6+,9-7+,24-10+; |
| InChIKey | IZXLLOKGWWQEQW-ONBAMLSFSA-N |
| XLogP | 4.61 |
| TPSA | 124.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.67 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|